C14H16ClNOS — CID 100697175
(3R)-3-[(3-chlorothiophen-2-yl)methylamino]-3-phenylpropan-1-ol (PubChem CID 100697175) has the molecular formula C14H16ClNOS and a molecular weight of 281.81 g/mol. Its IUPAC name is (3R)-3-[(3-chlorothiophen-2-yl)methylamino]-3-phenylpropan-1-ol.
| Compound Name | (3R)-3-[(3-chlorothiophen-2-yl)methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 100697175 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (3R)-3-[(3-chlorothiophen-2-yl)methylamino]-3-phenylpropan-1-ol |
| SMILES | OCC[C@@H](NCc1sccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H16ClNOS/c15-12-7-9-18-14(12)10-16-13(6-8-17)11-4-2-1-3-5-11/h1-5,7,9,13,16-17H,6,8,10H2/t13-/m1/s1 |
| InChIKey | ACRKNDWPOBEJQW-CYBMUJFWSA-N |
| XLogP | 3.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |