C16H22N2S — CID 66385749
2-[[(3-methyl-1-phenylbutyl)amino]methyl]thiophen-3-amine (PubChem CID 66385749) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-[[(3-methyl-1-phenylbutyl)amino]methyl]thiophen-3-amine.
| Compound Name | 2-[[(3-methyl-1-phenylbutyl)amino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66385749 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-[[(3-methyl-1-phenylbutyl)amino]methyl]thiophen-3-amine |
| SMILES | CC(C)CC(NCc1sccc1N)c1ccccc1 |
| InChI | InChI=1S/C16H22N2S/c1-12(2)10-15(13-6-4-3-5-7-13)18-11-16-14(17)8-9-19-16/h3-9,12,15,18H,10-11,17H2,1-2H3 |
| InChIKey | WIFHARIESNLWHK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |