C10H18N2S — CID 66386521
2-[(3-methylbutan-2-ylamino)methyl]thiophen-3-amine (PubChem CID 66386521) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-[(3-methylbutan-2-ylamino)methyl]thiophen-3-amine.
| Compound Name | 2-[(3-methylbutan-2-ylamino)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66386521 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-[(3-methylbutan-2-ylamino)methyl]thiophen-3-amine |
| SMILES | CC(C)C(C)NCc1sccc1N |
| InChI | InChI=1S/C10H18N2S/c1-7(2)8(3)12-6-10-9(11)4-5-13-10/h4-5,7-8,12H,6,11H2,1-3H3 |
| InChIKey | DJNBWJYLMCFSJW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |