C13H14F2N2S — CID 66385737
2-[[1-(2,4-difluorophenyl)ethylamino]methyl]thiophen-3-amine (PubChem CID 66385737) has the molecular formula C13H14F2N2S and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-[[1-(2,4-difluorophenyl)ethylamino]methyl]thiophen-3-amine.
| Compound Name | 2-[[1-(2,4-difluorophenyl)ethylamino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66385737 |
| Molecular Formula | C13H14F2N2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[[1-(2,4-difluorophenyl)ethylamino]methyl]thiophen-3-amine |
| SMILES | CC(NCc1sccc1N)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2S/c1-8(10-3-2-9(14)6-11(10)15)17-7-13-12(16)4-5-18-13/h2-6,8,17H,7,16H2,1H3 |
| InChIKey | RBQHLYPYUPGCDM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |