C16H17Cl2NO2 — CID 111449956
2,4-dichloro-6-[[[(1R)-3-hydroxy-1-phenylpropyl]amino]methyl]phenol (PubChem CID 111449956) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2,4-dichloro-6-[[[(1R)-3-hydroxy-1-phenylpropyl]amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[[(1R)-3-hydroxy-1-phenylpropyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 111449956 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2,4-dichloro-6-[[[(1R)-3-hydroxy-1-phenylpropyl]amino]methyl]phenol |
| SMILES | OCC[C@@H](NCc1cc(Cl)cc(Cl)c1O)c1ccccc1 |
| InChI | InChI=1S/C16H17Cl2NO2/c17-13-8-12(16(21)14(18)9-13)10-19-15(6-7-20)11-4-2-1-3-5-11/h1-5,8-9,15,19-21H,6-7,10H2/t15-/m1/s1 |
| InChIKey | XCJCGQQJROODEW-OAHLLOKOSA-N |
| XLogP | 3.91 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|