C16H16BrCl2NO — CID 43692342
2-[[1-(4-bromophenyl)propylamino]methyl]-4,6-dichlorophenol (PubChem CID 43692342) has the molecular formula C16H16BrCl2NO and a molecular weight of 389.12 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)propylamino]methyl]-4,6-dichlorophenol.
| Compound Name | 2-[[1-(4-bromophenyl)propylamino]methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 43692342 |
| Molecular Formula | C16H16BrCl2NO |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 2-[[1-(4-bromophenyl)propylamino]methyl]-4,6-dichlorophenol |
| SMILES | CCC(NCc1cc(Cl)cc(Cl)c1O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrCl2NO/c1-2-15(10-3-5-12(17)6-4-10)20-9-11-7-13(18)8-14(19)16(11)21/h3-8,15,20-21H,2,9H2,1H3 |
| InChIKey | BOSXANOCGRWQAU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|