C12H14Cl2N2O — CID 55101793
3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]pentanenitrile (PubChem CID 55101793) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]pentanenitrile.
| Compound Name | 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 55101793 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H14Cl2N2O/c1-2-10(3-4-15)16-7-8-5-9(13)6-11(14)12(8)17/h5-6,10,16-17H,2-3,7H2,1H3 |
| InChIKey | XWOKGBBIXKNLHK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|