C12H15BrN2O — CID 104695396
3-[(5-bromo-2-hydroxyphenyl)methylamino]pentanenitrile (PubChem CID 104695396) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)methylamino]pentanenitrile.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 104695396 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1cc(Br)ccc1O |
| InChI | InChI=1S/C12H15BrN2O/c1-2-11(5-6-14)15-8-9-7-10(13)3-4-12(9)16/h3-4,7,11,15-16H,2,5,8H2,1H3 |
| InChIKey | KXTWIZRVIRQHRY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|