C12H14Cl2N2 — CID 62646740
3-[(2,4-dichlorophenyl)methylamino]pentanenitrile (PubChem CID 62646740) has the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylamino]pentanenitrile.
| Compound Name | 3-[(2,4-dichlorophenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 62646740 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2/c1-2-11(5-6-15)16-8-9-3-4-10(13)7-12(9)14/h3-4,7,11,16H,2,5,8H2,1H3 |
| InChIKey | OJVMUODGTKUGKB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |