C13H17ClN2 — CID 102663768
3-chloro-4-[(pentan-3-ylamino)methyl]benzonitrile (PubChem CID 102663768) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 3-chloro-4-[(pentan-3-ylamino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(pentan-3-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102663768 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-chloro-4-[(pentan-3-ylamino)methyl]benzonitrile |
| SMILES | CCC(CC)NCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C13H17ClN2/c1-3-12(4-2)16-9-11-6-5-10(8-15)7-13(11)14/h5-7,12,16H,3-4,9H2,1-2H3 |
| InChIKey | UYPHNZUHDJXYJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |