C13H17ClN2O — CID 102664768
3-chloro-4-[(5-hydroxypentan-2-ylamino)methyl]benzonitrile (PubChem CID 102664768) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-chloro-4-[(5-hydroxypentan-2-ylamino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(5-hydroxypentan-2-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102664768 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-chloro-4-[(5-hydroxypentan-2-ylamino)methyl]benzonitrile |
| SMILES | CC(CCCO)NCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O/c1-10(3-2-6-17)16-9-12-5-4-11(8-15)7-13(12)14/h4-5,7,10,16-17H,2-3,6,9H2,1H3 |
| InChIKey | IGPTUTVGNFPPEI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |