C15H15ClN2S — CID 102664253
3-chloro-4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]benzonitrile (PubChem CID 102664253) has the molecular formula C15H15ClN2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 3-chloro-4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102664253 |
| Molecular Formula | C15H15ClN2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-chloro-4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]benzonitrile |
| SMILES | CC(Cc1ccsc1)NCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C15H15ClN2S/c1-11(6-13-4-5-19-10-13)18-9-14-3-2-12(8-17)7-15(14)16/h2-5,7,10-11,18H,6,9H2,1H3 |
| InChIKey | IUEWONARINLWHX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |