C14H15N3S — CID 63882119
4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]pyridine-2-carbonitrile (PubChem CID 63882119) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]pyridine-2-carbonitrile.
| Compound Name | 4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63882119 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-[(1-thiophen-3-ylpropan-2-ylamino)methyl]pyridine-2-carbonitrile |
| SMILES | CC(Cc1ccsc1)NCc1ccnc(C#N)c1 |
| InChI | InChI=1S/C14H15N3S/c1-11(6-13-3-5-18-10-13)17-9-12-2-4-16-14(7-12)8-15/h2-5,7,10-11,17H,6,9H2,1H3 |
| InChIKey | PJPRWCUHUFTABP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |