C11H14N2OS — CID 115726363
N-(1,2-oxazol-3-ylmethyl)-1-thiophen-3-ylpropan-2-amine (PubChem CID 115726363) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-1-thiophen-3-ylpropan-2-amine.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 115726363 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-1-thiophen-3-ylpropan-2-amine |
| SMILES | CC(Cc1ccsc1)NCc1ccon1 |
| InChI | InChI=1S/C11H14N2OS/c1-9(6-10-3-5-15-8-10)12-7-11-2-4-14-13-11/h2-5,8-9,12H,6-7H2,1H3 |
| InChIKey | RDGATJWMOSDVTA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |