C14H14Cl3NS — CID 78943901
1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-2-amine (PubChem CID 78943901) has the molecular formula C14H14Cl3NS and a molecular weight of 334.70 g/mol. Its IUPAC name is 1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-2-amine.
| Compound Name | 1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 78943901 |
| Molecular Formula | C14H14Cl3NS |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]propan-2-amine |
| SMILES | CC(Cc1ccsc1)NCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H14Cl3NS/c1-9(6-10-4-5-19-8-10)18-7-11-12(15)2-3-13(16)14(11)17/h2-5,8-9,18H,6-7H2,1H3 |
| InChIKey | BGZPLYHXTXBMBD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|