C12H10Cl3NS — CID 78922167
1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]methanamine (PubChem CID 78922167) has the molecular formula C12H10Cl3NS and a molecular weight of 306.64 g/mol. Its IUPAC name is 1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]methanamine.
| Compound Name | 1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 78922167 |
| Molecular Formula | C12H10Cl3NS |
| Molecular Weight | 306.64 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 1-thiophen-3-yl-N-[(2,3,6-trichlorophenyl)methyl]methanamine |
| SMILES | Clc1ccc(Cl)c(CNCc2ccsc2)c1Cl |
| InChI | InChI=1S/C12H10Cl3NS/c13-10-1-2-11(14)12(15)9(10)6-16-5-8-3-4-17-7-8/h1-4,7,16H,5-6H2 |
| InChIKey | YNOQBFJMCJFQGP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|