C13H12Cl3NS — CID 63247881
N-(thiophen-3-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 63247881) has the molecular formula C13H12Cl3NS and a molecular weight of 320.67 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-(thiophen-3-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 63247881 |
| Molecular Formula | C13H12Cl3NS |
| Molecular Weight | 320.67 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | N-(thiophen-3-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | CC(NCc1ccsc1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl3NS/c1-8(17-6-9-4-5-18-7-9)10-2-3-11(14)13(16)12(10)15/h2-5,7-8,17H,6H2,1H3 |
| InChIKey | XFGQFEASXVQIBY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|