C13H13Cl3N2S — CID 55170716
N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 55170716) has the molecular formula C13H13Cl3N2S and a molecular weight of 335.69 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 55170716 |
| Molecular Formula | C13H13Cl3N2S |
| Molecular Weight | 335.69 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | Cc1ncsc1CNC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H13Cl3N2S/c1-7(17-5-11-8(2)18-6-19-11)9-3-4-10(14)13(16)12(9)15/h3-4,6-7,17H,5H2,1-2H3 |
| InChIKey | KMFXWYKTWCAHNT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|