C12H11Cl3N2S — CID 104585412
N-(1,3-thiazol-5-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 104585412) has the molecular formula C12H11Cl3N2S and a molecular weight of 321.66 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-(1,3-thiazol-5-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 104585412 |
| Molecular Formula | C12H11Cl3N2S |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | N-(1,3-thiazol-5-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | CC(NCc1cncs1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H11Cl3N2S/c1-7(17-5-8-4-16-6-18-8)9-2-3-10(13)12(15)11(9)14/h2-4,6-7,17H,5H2,1H3 |
| InChIKey | QEYHRWUFWRXAOO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|