C12H14N2S — CID 81351888
(1R)-1-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine (PubChem CID 81351888) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is (1R)-1-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine.
| Compound Name | (1R)-1-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81351888 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1R)-1-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine |
| SMILES | C[C@@H](NCc1cncs1)c1ccccc1 |
| InChI | InChI=1S/C12H14N2S/c1-10(11-5-3-2-4-6-11)14-8-12-7-13-9-15-12/h2-7,9-10,14H,8H2,1H3/t10-/m1/s1 |
| InChIKey | RVFKRHUTHKSVHE-SNVBAGLBSA-N |
| XLogP | 2.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |