C12H13FN2S — CID 81365024
(1S)-1-(3-fluorophenyl)-N-(1,3-thiazol-5-ylmethyl)ethanamine (PubChem CID 81365024) has the molecular formula C12H13FN2S and a molecular weight of 236.32 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)-N-(1,3-thiazol-5-ylmethyl)ethanamine.
| Compound Name | (1S)-1-(3-fluorophenyl)-N-(1,3-thiazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81365024 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)-N-(1,3-thiazol-5-ylmethyl)ethanamine |
| SMILES | C[C@H](NCc1cncs1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H13FN2S/c1-9(10-3-2-4-11(13)5-10)15-7-12-6-14-8-16-12/h2-6,8-9,15H,7H2,1H3/t9-/m0/s1 |
| InChIKey | NGTNBVXUISATQZ-VIFPVBQESA-N |
| XLogP | 3.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |