C16H16Cl3NS — CID 63452712
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 63452712) has the molecular formula C16H16Cl3NS and a molecular weight of 360.74 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 63452712 |
| Molecular Formula | C16H16Cl3NS |
| Molecular Weight | 360.74 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | CC(NCc1cc2c(s1)CCC2)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl3NS/c1-9(12-5-6-13(17)16(19)15(12)18)20-8-11-7-10-3-2-4-14(10)21-11/h5-7,9,20H,2-4,8H2,1H3 |
| InChIKey | BPAXGPVIZMUBEI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|