C9H8Cl3F2N — CID 115405634
2,2-difluoro-N-[(2,3,6-trichlorophenyl)methyl]ethanamine (PubChem CID 115405634) has the molecular formula C9H8Cl3F2N and a molecular weight of 274.52 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2,3,6-trichlorophenyl)methyl]ethanamine.
| Compound Name | 2,2-difluoro-N-[(2,3,6-trichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115405634 |
| Molecular Formula | C9H8Cl3F2N |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 2,2-difluoro-N-[(2,3,6-trichlorophenyl)methyl]ethanamine |
| SMILES | FC(F)CNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3F2N/c10-6-1-2-7(11)9(12)5(6)3-15-4-8(13)14/h1-2,8,15H,3-4H2 |
| InChIKey | BGPCPGFIDMXJIJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|