C13H8Cl4FN — CID 43772414
3-chloro-4-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline (PubChem CID 43772414) has the molecular formula C13H8Cl4FN and a molecular weight of 339.02 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline.
| Compound Name | 3-chloro-4-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 43772414 |
| Molecular Formula | C13H8Cl4FN |
| Molecular Weight | 339.02 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | 3-chloro-4-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline |
| SMILES | Fc1ccc(NCc2c(Cl)ccc(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl4FN/c14-9-2-3-10(15)13(17)8(9)6-19-7-1-4-12(18)11(16)5-7/h1-5,19H,6H2 |
| InChIKey | SGRDLQGFOUCSTP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.02 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|