C13H8Cl3FN2O2 — CID 43785712
4-fluoro-3-nitro-N-[(2,3,6-trichlorophenyl)methyl]aniline (PubChem CID 43785712) has the molecular formula C13H8Cl3FN2O2 and a molecular weight of 349.58 g/mol. Its IUPAC name is 4-fluoro-3-nitro-N-[(2,3,6-trichlorophenyl)methyl]aniline.
| Compound Name | 4-fluoro-3-nitro-N-[(2,3,6-trichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 43785712 |
| Molecular Formula | C13H8Cl3FN2O2 |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 4-fluoro-3-nitro-N-[(2,3,6-trichlorophenyl)methyl]aniline |
| SMILES | O=[N+]([O-])c1cc(NCc2c(Cl)ccc(Cl)c2Cl)ccc1F |
| InChI | InChI=1S/C13H8Cl3FN2O2/c14-9-2-3-10(15)13(16)8(9)6-18-7-1-4-11(17)12(5-7)19(20)21/h1-5,18H,6H2 |
| InChIKey | BBWGLORRIOCROH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|