C14H10Cl2FN3O3 — CID 9099793
N-(3,4-dichlorophenyl)-2-(4-fluoro-3-nitroanilino)acetamide (PubChem CID 9099793) has the molecular formula C14H10Cl2FN3O3 and a molecular weight of 358.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(4-fluoro-3-nitroanilino)acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(4-fluoro-3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 9099793 |
| Molecular Formula | C14H10Cl2FN3O3 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(4-fluoro-3-nitroanilino)acetamide |
| SMILES | O=C(CNc1ccc(F)c([N+](=O)[O-])c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2FN3O3/c15-10-3-1-9(5-11(10)16)19-14(21)7-18-8-2-4-12(17)13(6-8)20(22)23/h1-6,18H,7H2,(H,19,21) |
| InChIKey | LSARGXFRDAFTNV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|