C13H9Cl3FN — CID 43763353
2-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline (PubChem CID 43763353) has the molecular formula C13H9Cl3FN and a molecular weight of 304.58 g/mol. Its IUPAC name is 2-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline.
| Compound Name | 2-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 43763353 |
| Molecular Formula | C13H9Cl3FN |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 2-fluoro-N-[(2,3,6-trichlorophenyl)methyl]aniline |
| SMILES | Fc1ccccc1NCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl3FN/c14-9-5-6-10(15)13(16)8(9)7-18-12-4-2-1-3-11(12)17/h1-6,18H,7H2 |
| InChIKey | CQCOIKZZJLBIGR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|