C14H9Cl3F3N — CID 43758457
N-[(2,3,6-trichlorophenyl)methyl]-2-(trifluoromethyl)aniline (PubChem CID 43758457) has the molecular formula C14H9Cl3F3N and a molecular weight of 354.59 g/mol. Its IUPAC name is N-[(2,3,6-trichlorophenyl)methyl]-2-(trifluoromethyl)aniline.
| Compound Name | N-[(2,3,6-trichlorophenyl)methyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43758457 |
| Molecular Formula | C14H9Cl3F3N |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | N-[(2,3,6-trichlorophenyl)methyl]-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccccc1NCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H9Cl3F3N/c15-10-5-6-11(16)13(17)8(10)7-21-12-4-2-1-3-9(12)14(18,19)20/h1-6,21H,7H2 |
| InChIKey | KOWDDMJWUMZRQP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|