C14H11Cl4N — CID 43772671
2-chloro-4-methyl-N-[(2,3,6-trichlorophenyl)methyl]aniline (PubChem CID 43772671) has the molecular formula C14H11Cl4N and a molecular weight of 335.06 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(2,3,6-trichlorophenyl)methyl]aniline.
| Compound Name | 2-chloro-4-methyl-N-[(2,3,6-trichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 43772671 |
| Molecular Formula | C14H11Cl4N |
| Molecular Weight | 335.06 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-chloro-4-methyl-N-[(2,3,6-trichlorophenyl)methyl]aniline |
| SMILES | Cc1ccc(NCc2c(Cl)ccc(Cl)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl4N/c1-8-2-5-13(12(17)6-8)19-7-9-10(15)3-4-11(16)14(9)18/h2-6,19H,7H2,1H3 |
| InChIKey | QERYECYTEOJHNJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|