C14H10Cl3FN2O — CID 43783759
4-fluoro-3-[(2,3,6-trichlorophenyl)methylamino]benzamide (PubChem CID 43783759) has the molecular formula C14H10Cl3FN2O and a molecular weight of 347.60 g/mol. Its IUPAC name is 4-fluoro-3-[(2,3,6-trichlorophenyl)methylamino]benzamide.
| Compound Name | 4-fluoro-3-[(2,3,6-trichlorophenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 43783759 |
| Molecular Formula | C14H10Cl3FN2O |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 4-fluoro-3-[(2,3,6-trichlorophenyl)methylamino]benzamide |
| SMILES | NC(=O)c1ccc(F)c(NCc2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H10Cl3FN2O/c15-9-2-3-10(16)13(17)8(9)6-20-12-5-7(14(19)21)1-4-11(12)18/h1-5,20H,6H2,(H2,19,21) |
| InChIKey | SMAWJATUGSVHTF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|