C14H11ClF2N2O2 — CID 79881862
4-chloro-3-[(3,5-difluoro-4-hydroxyphenyl)methylamino]benzamide (PubChem CID 79881862) has the molecular formula C14H11ClF2N2O2 and a molecular weight of 312.70 g/mol. Its IUPAC name is 4-chloro-3-[(3,5-difluoro-4-hydroxyphenyl)methylamino]benzamide.
| Compound Name | 4-chloro-3-[(3,5-difluoro-4-hydroxyphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 79881862 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-chloro-3-[(3,5-difluoro-4-hydroxyphenyl)methylamino]benzamide |
| SMILES | NC(=O)c1ccc(Cl)c(NCc2cc(F)c(O)c(F)c2)c1 |
| InChI | InChI=1S/C14H11ClF2N2O2/c15-9-2-1-8(14(18)21)5-12(9)19-6-7-3-10(16)13(20)11(17)4-7/h1-5,19-20H,6H2,(H2,18,21) |
| InChIKey | LDHMCDHIBUPAGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |