C15H14Cl2N2O — CID 106816294
4-chloro-3-[(3-chloro-4-methylphenyl)methylamino]benzamide (PubChem CID 106816294) has the molecular formula C15H14Cl2N2O and a molecular weight of 309.20 g/mol. Its IUPAC name is 4-chloro-3-[(3-chloro-4-methylphenyl)methylamino]benzamide.
| Compound Name | 4-chloro-3-[(3-chloro-4-methylphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 106816294 |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-chloro-3-[(3-chloro-4-methylphenyl)methylamino]benzamide |
| SMILES | Cc1ccc(CNc2cc(C(N)=O)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O/c1-9-2-3-10(6-13(9)17)8-19-14-7-11(15(18)20)4-5-12(14)16/h2-7,19H,8H2,1H3,(H2,18,20) |
| InChIKey | WTRUXJNQPRSYAX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |