C11H14Cl3NO — CID 78954209
2-methyl-1-[(2,3,6-trichlorophenyl)methylamino]propan-2-ol (PubChem CID 78954209) has the molecular formula C11H14Cl3NO and a molecular weight of 282.60 g/mol. Its IUPAC name is 2-methyl-1-[(2,3,6-trichlorophenyl)methylamino]propan-2-ol.
| Compound Name | 2-methyl-1-[(2,3,6-trichlorophenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 78954209 |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-methyl-1-[(2,3,6-trichlorophenyl)methylamino]propan-2-ol |
| SMILES | CC(C)(O)CNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl3NO/c1-11(2,16)6-15-5-7-8(12)3-4-9(13)10(7)14/h3-4,15-16H,5-6H2,1-2H3 |
| InChIKey | ZOENORKVSHFLDA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|