C12H17Cl3N2 — CID 115282416
2-N,2-N-dimethyl-1-N-[(2,3,6-trichlorophenyl)methyl]propane-1,2-diamine (PubChem CID 115282416) has the molecular formula C12H17Cl3N2 and a molecular weight of 295.64 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-[(2,3,6-trichlorophenyl)methyl]propane-1,2-diamine.
| Compound Name | 2-N,2-N-dimethyl-1-N-[(2,3,6-trichlorophenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 115282416 |
| Molecular Formula | C12H17Cl3N2 |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-[(2,3,6-trichlorophenyl)methyl]propane-1,2-diamine |
| SMILES | CC(CNCc1c(Cl)ccc(Cl)c1Cl)N(C)C |
| InChI | InChI=1S/C12H17Cl3N2/c1-8(17(2)3)6-16-7-9-10(13)4-5-11(14)12(9)15/h4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | BXRJYGAYKWVZIK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|