C14H20Cl3NO — CID 106007740
4-propan-2-yloxy-N-[(2,3,6-trichlorophenyl)methyl]butan-1-amine (PubChem CID 106007740) has the molecular formula C14H20Cl3NO and a molecular weight of 324.68 g/mol. Its IUPAC name is 4-propan-2-yloxy-N-[(2,3,6-trichlorophenyl)methyl]butan-1-amine.
| Compound Name | 4-propan-2-yloxy-N-[(2,3,6-trichlorophenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106007740 |
| Molecular Formula | C14H20Cl3NO |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-propan-2-yloxy-N-[(2,3,6-trichlorophenyl)methyl]butan-1-amine |
| SMILES | CC(C)OCCCCNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl3NO/c1-10(2)19-8-4-3-7-18-9-11-12(15)5-6-13(16)14(11)17/h5-6,10,18H,3-4,7-9H2,1-2H3 |
| InChIKey | MPXGNPOPQQSOAL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|