C12H15Cl3N2O — CID 106234618
5-[(2,3,6-trichlorophenyl)methylamino]pentanamide (PubChem CID 106234618) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is 5-[(2,3,6-trichlorophenyl)methylamino]pentanamide.
| Compound Name | 5-[(2,3,6-trichlorophenyl)methylamino]pentanamide |
|---|---|
| PubChem CID | 106234618 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-[(2,3,6-trichlorophenyl)methylamino]pentanamide |
| SMILES | NC(=O)CCCCNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl3N2O/c13-9-4-5-10(14)12(15)8(9)7-17-6-2-1-3-11(16)18/h4-5,17H,1-3,6-7H2,(H2,16,18) |
| InChIKey | OWJJOHSQLADHAV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|