C9H13ClN2OS — CID 60863033
4-[(5-chlorothiophen-2-yl)methylamino]butanamide (PubChem CID 60863033) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methylamino]butanamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 60863033 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methylamino]butanamide |
| SMILES | NC(=O)CCCNCc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H13ClN2OS/c10-8-4-3-7(14-8)6-12-5-1-2-9(11)13/h3-4,12H,1-2,5-6H2,(H2,11,13) |
| InChIKey | JHDOKUNOWAPZHF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|