C12H12ClNO2S2 — CID 82894964
2-[5-[[(5-chlorothiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetic acid (PubChem CID 82894964) has the molecular formula C12H12ClNO2S2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-[5-[[(5-chlorothiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[(5-chlorothiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82894964 |
| Molecular Formula | C12H12ClNO2S2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 2-[5-[[(5-chlorothiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNCc2ccc(Cl)s2)s1 |
| InChI | InChI=1S/C12H12ClNO2S2/c13-11-4-3-10(18-11)7-14-6-9-2-1-8(17-9)5-12(15)16/h1-4,14H,5-7H2,(H,15,16) |
| InChIKey | YKMNQRSGEMRFCP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |