C10H12F3NO2S — CID 82894882
2-[5-[(3,3,3-trifluoropropylamino)methyl]thiophen-2-yl]acetic acid (PubChem CID 82894882) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-[5-[(3,3,3-trifluoropropylamino)methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(3,3,3-trifluoropropylamino)methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82894882 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-[5-[(3,3,3-trifluoropropylamino)methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H12F3NO2S/c11-10(12,13)3-4-14-6-8-2-1-7(17-8)5-9(15)16/h1-2,14H,3-6H2,(H,15,16) |
| InChIKey | LJLMLXSSHDOJIP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|