C15H17NO3S — CID 82894428
2-[5-[[2-(4-hydroxyphenyl)ethylamino]methyl]thiophen-2-yl]acetic acid (PubChem CID 82894428) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[5-[[2-(4-hydroxyphenyl)ethylamino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[2-(4-hydroxyphenyl)ethylamino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82894428 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[5-[[2-(4-hydroxyphenyl)ethylamino]methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNCCc2ccc(O)cc2)s1 |
| InChI | InChI=1S/C15H17NO3S/c17-12-3-1-11(2-4-12)7-8-16-10-14-6-5-13(20-14)9-15(18)19/h1-6,16-17H,7-10H2,(H,18,19) |
| InChIKey | BNQOCHKXZINGFA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|