C12H17NO3S — CID 82894996
2-[5-[(3-ethenoxypropylamino)methyl]thiophen-2-yl]acetic acid (PubChem CID 82894996) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-[5-[(3-ethenoxypropylamino)methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(3-ethenoxypropylamino)methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82894996 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[5-[(3-ethenoxypropylamino)methyl]thiophen-2-yl]acetic acid |
| SMILES | C=COCCCNCc1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C12H17NO3S/c1-2-16-7-3-6-13-9-11-5-4-10(17-11)8-12(14)15/h2,4-5,13H,1,3,6-9H2,(H,14,15) |
| InChIKey | RGZNIOKOULKUKF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|