C9H11N3OS — CID 115919596
3-[(5-cyanothiophen-2-yl)methylamino]propanamide (PubChem CID 115919596) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-[(5-cyanothiophen-2-yl)methylamino]propanamide.
| Compound Name | 3-[(5-cyanothiophen-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 115919596 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-[(5-cyanothiophen-2-yl)methylamino]propanamide |
| SMILES | N#Cc1ccc(CNCCC(N)=O)s1 |
| InChI | InChI=1S/C9H11N3OS/c10-5-7-1-2-8(14-7)6-12-4-3-9(11)13/h1-2,12H,3-4,6H2,(H2,11,13) |
| InChIKey | VOZFRSQMSKXBIJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|