C12H16N2O2S — CID 115978305
tert-butyl 2-[(5-cyanothiophen-2-yl)methylamino]acetate (PubChem CID 115978305) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is tert-butyl 2-[(5-cyanothiophen-2-yl)methylamino]acetate.
| Compound Name | tert-butyl 2-[(5-cyanothiophen-2-yl)methylamino]acetate |
|---|---|
| PubChem CID | 115978305 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | tert-butyl 2-[(5-cyanothiophen-2-yl)methylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCc1ccc(C#N)s1 |
| InChI | InChI=1S/C12H16N2O2S/c1-12(2,3)16-11(15)8-14-7-10-5-4-9(6-13)17-10/h4-5,14H,7-8H2,1-3H3 |
| InChIKey | IWTCZPHWPYGBOH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |