C16H25NO4S — CID 160927254
tert-butyl 2-[(5-tert-butylthiophen-2-yl)methylamino]acetate;carbon dioxide (PubChem CID 160927254) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is tert-butyl 2-[(5-tert-butylthiophen-2-yl)methylamino]acetate;carbon dioxide.
| Compound Name | tert-butyl 2-[(5-tert-butylthiophen-2-yl)methylamino]acetate;carbon dioxide |
|---|---|
| PubChem CID | 160927254 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl 2-[(5-tert-butylthiophen-2-yl)methylamino]acetate;carbon dioxide |
| SMILES | CC(C)(C)OC(=O)CNCc1ccc(C(C)(C)C)s1.O=C=O |
| InChI | InChI=1S/C15H25NO2S.CO2/c1-14(2,3)12-8-7-11(19-12)9-16-10-13(17)18-15(4,5)6;2-1-3/h7-8,16H,9-10H2,1-6H3; |
| InChIKey | SSUMWJWVUVGEJS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |