C17H28N2O2S — CID 107238324
tert-butyl N-[2-[(5-tert-butylthiophen-2-yl)methylamino]cyclopropyl]carbamate (PubChem CID 107238324) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-tert-butylthiophen-2-yl)methylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-tert-butylthiophen-2-yl)methylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238324 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | tert-butyl N-[2-[(5-tert-butylthiophen-2-yl)methylamino]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1NCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C17H28N2O2S/c1-16(2,3)14-8-7-11(22-14)10-18-12-9-13(12)19-15(20)21-17(4,5)6/h7-8,12-13,18H,9-10H2,1-6H3,(H,19,20) |
| InChIKey | GPUPGJCITIQGPQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |