C13H19BrN2O2S — CID 107238273
tert-butyl N-[2-[(5-bromothiophen-2-yl)methylamino]cyclopropyl]carbamate (PubChem CID 107238273) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromothiophen-2-yl)methylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-bromothiophen-2-yl)methylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238273 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | tert-butyl N-[2-[(5-bromothiophen-2-yl)methylamino]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H19BrN2O2S/c1-13(2,3)18-12(17)16-10-6-9(10)15-7-8-4-5-11(14)19-8/h4-5,9-10,15H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | GGYCENAOSUNYBN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |