C15H19F3N2O2 — CID 107238083
tert-butyl N-[2-[(3,4,5-trifluorophenyl)methylamino]cyclopropyl]carbamate (PubChem CID 107238083) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is tert-butyl N-[2-[(3,4,5-trifluorophenyl)methylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3,4,5-trifluorophenyl)methylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238083 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl N-[2-[(3,4,5-trifluorophenyl)methylamino]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-15(2,3)22-14(21)20-12-6-11(12)19-7-8-4-9(16)13(18)10(17)5-8/h4-5,11-12,19H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | FHTVUIRKUXLKEZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|