C16H22N2O5 — CID 107238105
tert-butyl N-[2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]cyclopropyl]carbamate (PubChem CID 107238105) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238105 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | tert-butyl N-[2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1NCc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C16H22N2O5/c1-16(2,3)23-15(20)18-11-5-10(11)17-7-9-4-13-14(6-12(9)19)22-8-21-13/h4,6,10-11,17,19H,5,7-8H2,1-3H3,(H,18,20) |
| InChIKey | SCYTURGSOCZNCC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|