C13H18N2O5 — CID 107237244
tert-butyl N-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]carbamate (PubChem CID 107237244) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is tert-butyl N-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107237244 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | tert-butyl N-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNCc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C13H18N2O5/c1-13(2,3)20-12(17)15-14-6-8-4-10-11(5-9(8)16)19-7-18-10/h4-5,14,16H,6-7H2,1-3H3,(H,15,17) |
| InChIKey | VLZZORMSOYRISH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|