C12H15NO5 — CID 55012550
ethyl 2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]acetate (PubChem CID 55012550) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is ethyl 2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]acetate.
| Compound Name | ethyl 2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]acetate |
|---|---|
| PubChem CID | 55012550 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | ethyl 2-[(6-hydroxy-1,3-benzodioxol-5-yl)methylamino]acetate |
| SMILES | CCOC(=O)CNCc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C12H15NO5/c1-2-16-12(15)6-13-5-8-3-10-11(4-9(8)14)18-7-17-10/h3-4,13-14H,2,5-7H2,1H3 |
| InChIKey | VWYZBZWTXUPHFA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|